About CID 158857215
CID 158857215 (PubChem CID 158857215) has the molecular formula C16H20Si
and a molecular weight of 240.42 g/mol.
Molecular Properties
| Compound Name | CID 158857215 |
| PubChem CID | 158857215 |
| Molecular Formula | C16H20Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | — |
| SMILES | CCCC.c1ccc([Si]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Si.C4H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-4-2/h1-10H;3-4H2,1-2H3 |
| InChIKey | JAFBDDPNOWDJHY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158857215 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158857215?
The IUPAC name of CID 158857215 (CID 158857215) is not available.
What is the SMILES notation for CID 158857215?
The canonical SMILES for CID 158857215 is CCCC.c1ccc([Si]c2ccccc2)cc1.
What is the InChIKey of CID 158857215?
The InChIKey is JAFBDDPNOWDJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Si.C4H10/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-4-2/h1-10H;3-4H2,1-2H3.
What are the key properties of CID 158857215?
CID 158857215 has a molecular weight of 240.42 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158857215 is sourced from PubChem (CID 158857215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).