About CID 136865288
CID 136865288 (PubChem CID 136865288) has the molecular formula C16H18OSi
and a molecular weight of 254.41 g/mol.
Molecular Properties
| Compound Name | CID 136865288 |
| PubChem CID | 136865288 |
| Molecular Formula | C16H18OSi |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | — |
| SMILES | CCCCOc1ccc([Si]c2ccccc2)cc1 |
| InChI | InChI=1S/C16H18OSi/c1-2-3-13-17-14-9-11-16(12-10-14)18-15-7-5-4-6-8-15/h4-12H,2-3,13H2,1H3 |
| InChIKey | CGCGLEXSSIDAKJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136865288 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136865288?
The IUPAC name of CID 136865288 (CID 136865288) is not available.
What is the SMILES notation for CID 136865288?
The canonical SMILES for CID 136865288 is CCCCOc1ccc([Si]c2ccccc2)cc1.
What is the InChIKey of CID 136865288?
The InChIKey is CGCGLEXSSIDAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18OSi/c1-2-3-13-17-14-9-11-16(12-10-14)18-15-7-5-4-6-8-15/h4-12H,2-3,13H2,1H3.
What are the key properties of CID 136865288?
CID 136865288 has a molecular weight of 254.41 g/mol, XLogP of 2.52, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136865288 is sourced from PubChem (CID 136865288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).