About CID 11107165
CID 11107165 (PubChem CID 11107165) has the molecular formula C12H10OSi2
and a molecular weight of 226.38 g/mol.
Molecular Properties
| Compound Name | CID 11107165 |
| PubChem CID | 11107165 |
| Molecular Formula | C12H10OSi2 |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | — |
| SMILES | c1ccc([Si]O[Si]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10OSi2/c1-3-7-11(8-4-1)14-13-15-12-9-5-2-6-10-12/h1-10H |
| InChIKey | QTDOEXPQLVJTJE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11107165 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11107165?
The IUPAC name of CID 11107165 (CID 11107165) is not available.
What is the SMILES notation for CID 11107165?
The canonical SMILES for CID 11107165 is c1ccc([Si]O[Si]c2ccccc2)cc1.
What is the InChIKey of CID 11107165?
The InChIKey is QTDOEXPQLVJTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10OSi2/c1-3-7-11(8-4-1)14-13-15-12-9-5-2-6-10-12/h1-10H.
What are the key properties of CID 11107165?
CID 11107165 has a molecular weight of 226.38 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11107165 is sourced from PubChem (CID 11107165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).