C15H24ClN3O3S — CID 120568084
N-(5-amino-2-methylphenyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride (PubChem CID 120568084) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120568084 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-4-pyrrolidin-1-ylsulfonylbutanamide;hydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)CCCS(=O)(=O)N1CCCC1.Cl |
| InChI | InChI=1S/C15H23N3O3S.ClH/c1-12-6-7-13(16)11-14(12)17-15(19)5-4-10-22(20,21)18-8-2-3-9-18;/h6-7,11H,2-5,8-10,16H2,1H3,(H,17,19);1H |
| InChIKey | YRJIJYKLRNOOJF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|