C18H20F3N3O2S — CID 120581749
1-(3,4-dimethylphenyl)-2-[[4-methylsulfonyl-3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 120581749) has the molecular formula C18H20F3N3O2S and a molecular weight of 399.44 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[[4-methylsulfonyl-3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[[4-methylsulfonyl-3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 120581749 |
| Molecular Formula | C18H20F3N3O2S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[[4-methylsulfonyl-3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2ccc(S(C)(=O)=O)c(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C18H20F3N3O2S/c1-11-4-6-14(8-12(11)2)24-17(22)23-10-13-5-7-16(27(3,25)26)15(9-13)18(19,20)21/h4-9H,10H2,1-3H3,(H3,22,23,24) |
| InChIKey | RDSQNISIVFCFPK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|