C11H21ClN4O2S — CID 120582073
[1-(1-ethylimidazol-4-yl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120582073) has the molecular formula C11H21ClN4O2S and a molecular weight of 308.84 g/mol. Its IUPAC name is [1-(1-ethylimidazol-4-yl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(1-ethylimidazol-4-yl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120582073 |
| Molecular Formula | C11H21ClN4O2S |
| Molecular Weight | 308.84 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | [1-(1-ethylimidazol-4-yl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CCn1cnc(S(=O)(=O)N2CC(CN)CC2C)c1.Cl |
| InChI | InChI=1S/C11H20N4O2S.ClH/c1-3-14-7-11(13-8-14)18(16,17)15-6-10(5-12)4-9(15)2;/h7-10H,3-6,12H2,1-2H3;1H |
| InChIKey | ZGJUTHPEORBDBH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.84 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |