C11H24ClN3O2S — CID 120585482
4-methyl-1-(4-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 120585482) has the molecular formula C11H24ClN3O2S and a molecular weight of 297.85 g/mol. Its IUPAC name is 4-methyl-1-(4-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 4-methyl-1-(4-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120585482 |
| Molecular Formula | C11H24ClN3O2S |
| Molecular Weight | 297.85 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-methyl-1-(4-methylpiperidin-1-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | CC1CCN(S(=O)(=O)N2CC(C)C(N)C2)CC1.Cl |
| InChI | InChI=1S/C11H23N3O2S.ClH/c1-9-3-5-13(6-4-9)17(15,16)14-7-10(2)11(12)8-14;/h9-11H,3-8,12H2,1-2H3;1H |
| InChIKey | GCQKJIDVFPEOMS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.85 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |