C19H24ClN3O4 — CID 120586728
2-[(4-amino-3-methoxybutanoyl)amino]-N-(4-methoxyphenyl)benzamide;hydrochloride (PubChem CID 120586728) has the molecular formula C19H24ClN3O4 and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-[(4-amino-3-methoxybutanoyl)amino]-N-(4-methoxyphenyl)benzamide;hydrochloride.
| Compound Name | 2-[(4-amino-3-methoxybutanoyl)amino]-N-(4-methoxyphenyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120586728 |
| Molecular Formula | C19H24ClN3O4 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[(4-amino-3-methoxybutanoyl)amino]-N-(4-methoxyphenyl)benzamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)CC(CN)OC)cc1.Cl |
| InChI | InChI=1S/C19H23N3O4.ClH/c1-25-14-9-7-13(8-10-14)21-19(24)16-5-3-4-6-17(16)22-18(23)11-15(12-20)26-2;/h3-10,15H,11-12,20H2,1-2H3,(H,21,24)(H,22,23);1H |
| InChIKey | KVEXWXOEOSRSGB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |