C24H32N3O3+ — CID 9265622
cyclooctyl-[2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]azanium (PubChem CID 9265622) has the molecular formula C24H32N3O3+ and a molecular weight of 410.54 g/mol. Its IUPAC name is cyclooctyl-[2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]azanium.
| Compound Name | cyclooctyl-[2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9265622 |
| Molecular Formula | C24H32N3O3+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | cyclooctyl-[2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]azanium |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)C[NH2+]C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-30-20-15-13-19(14-16-20)26-24(29)21-11-7-8-12-22(21)27-23(28)17-25-18-9-5-3-2-4-6-10-18/h7-8,11-16,18,25H,2-6,9-10,17H2,1H3,(H,26,29)(H,27,28)/p+1 |
| InChIKey | NCVNCDQOVJMQDZ-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 84.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |