C21H26N3O4+ — CID 8000807
[2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 8000807) has the molecular formula C21H26N3O4+ and a molecular weight of 384.46 g/mol. Its IUPAC name is [2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8000807 |
| Molecular Formula | C21H26N3O4+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [2-[2-[(4-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | COc1ccc(NC(=O)c2ccccc2NC(=O)C[NH2+]C[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-16-10-8-15(9-11-16)23-21(26)18-6-2-3-7-19(18)24-20(25)14-22-13-17-5-4-12-28-17/h2-3,6-11,17,22H,4-5,12-14H2,1H3,(H,23,26)(H,24,25)/p+1/t17-/m1/s1 |
| InChIKey | XFEMIARKVJDRSB-QGZVFWFLSA-O |
| XLogP | 1.63 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |