C11H19ClN2O2S — CID 120587130
4-amino-3-methoxy-N-(2-thiophen-2-ylethyl)butanamide;hydrochloride (PubChem CID 120587130) has the molecular formula C11H19ClN2O2S and a molecular weight of 278.80 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(2-thiophen-2-ylethyl)butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-(2-thiophen-2-ylethyl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120587130 |
| Molecular Formula | C11H19ClN2O2S |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-amino-3-methoxy-N-(2-thiophen-2-ylethyl)butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)NCCc1cccs1.Cl |
| InChI | InChI=1S/C11H18N2O2S.ClH/c1-15-9(8-12)7-11(14)13-5-4-10-3-2-6-16-10;/h2-3,6,9H,4-5,7-8,12H2,1H3,(H,13,14);1H |
| InChIKey | FNMCRQFFBAPHIK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |