C16H26N2O4 — CID 120591848
4-amino-N-[1-(3,4-dimethoxyphenyl)propan-2-yl]-3-methoxybutanamide (PubChem CID 120591848) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 4-amino-N-[1-(3,4-dimethoxyphenyl)propan-2-yl]-3-methoxybutanamide.
| Compound Name | 4-amino-N-[1-(3,4-dimethoxyphenyl)propan-2-yl]-3-methoxybutanamide |
|---|---|
| PubChem CID | 120591848 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 4-amino-N-[1-(3,4-dimethoxyphenyl)propan-2-yl]-3-methoxybutanamide |
| SMILES | COc1ccc(CC(C)NC(=O)CC(CN)OC)cc1OC |
| InChI | InChI=1S/C16H26N2O4/c1-11(18-16(19)9-13(10-17)20-2)7-12-5-6-14(21-3)15(8-12)22-4/h5-6,8,11,13H,7,9-10,17H2,1-4H3,(H,18,19) |
| InChIKey | GKBAUZZTSKLZTL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |