C16H29N5O4 — CID 12059671
2-[2-[4-[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid (PubChem CID 12059671) has the molecular formula C16H29N5O4 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-[2-[4-[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid.
| Compound Name | 2-[2-[4-[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid |
|---|---|
| PubChem CID | 12059671 |
| Molecular Formula | C16H29N5O4 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 2-[2-[4-[2-(1-carboxyethylideneamino)ethyl]-1,4,7-triazonan-1-yl]ethylimino]propanoic acid |
| SMILES | C/C(=N\CCN1CCNCCN(CC/N=C(\C)C(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C16H29N5O4/c1-13(15(22)23)18-5-9-20-7-3-17-4-8-21(12-11-20)10-6-19-14(2)16(24)25/h17H,3-12H2,1-2H3,(H,22,23)(H,24,25)/b18-13+,19-14+ |
| InChIKey | QVXHGTDWWSBNAM-JIBZRZDWSA-N |
| XLogP | -0.72 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|