C20H22N2O4 — CID 1205994
1-[(4R)-6'-hydroxyimino-10,11-dimethoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-2,3'-cyclohexa-1,4-diene]-5-yl]ethanone (PubChem CID 1205994) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[(4R)-6'-hydroxyimino-10,11-dimethoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-2,3'-cyclohexa-1,4-diene]-5-yl]ethanone.
| Compound Name | 1-[(4R)-6'-hydroxyimino-10,11-dimethoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-2,3'-cyclohexa-1,4-diene]-5-yl]ethanone |
|---|---|
| PubChem CID | 1205994 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[(4R)-6'-hydroxyimino-10,11-dimethoxyspiro[5-azatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-2,3'-cyclohexa-1,4-diene]-5-yl]ethanone |
| SMILES | COc1cc2c3c(c1OC)C1(C=CC(=NO)C=C1)C[C@H]3N(C(C)=O)CC2 |
| InChI | InChI=1S/C20H22N2O4/c1-12(23)22-9-6-13-10-16(25-2)19(26-3)18-17(13)15(22)11-20(18)7-4-14(21-24)5-8-20/h4-5,7-8,10,15,24H,6,9,11H2,1-3H3/b21-14-/t15-,20?/m1/s1 |
| InChIKey | LJMCAUZYTAXYGT-VSKLNWQUSA-N |
| XLogP | 2.75 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|