C18H27ClN6O — CID 120600412
3-methyl-N-(2-methylpiperidin-4-yl)-2-(5-phenyltetrazol-2-yl)butanamide;hydrochloride (PubChem CID 120600412) has the molecular formula C18H27ClN6O and a molecular weight of 378.91 g/mol. Its IUPAC name is 3-methyl-N-(2-methylpiperidin-4-yl)-2-(5-phenyltetrazol-2-yl)butanamide;hydrochloride.
| Compound Name | 3-methyl-N-(2-methylpiperidin-4-yl)-2-(5-phenyltetrazol-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 120600412 |
| Molecular Formula | C18H27ClN6O |
| Molecular Weight | 378.91 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-methyl-N-(2-methylpiperidin-4-yl)-2-(5-phenyltetrazol-2-yl)butanamide;hydrochloride |
| SMILES | CC1CC(NC(=O)C(C(C)C)n2nnc(-c3ccccc3)n2)CCN1.Cl |
| InChI | InChI=1S/C18H26N6O.ClH/c1-12(2)16(18(25)20-15-9-10-19-13(3)11-15)24-22-17(21-23-24)14-7-5-4-6-8-14;/h4-8,12-13,15-16,19H,9-11H2,1-3H3,(H,20,25);1H |
| InChIKey | KEBNNQBPAFJOFJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.91 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |