C16H24BrClN2OS — CID 120601915
2-(4-bromophenyl)sulfanyl-2-methyl-N-(2-methylpiperidin-4-yl)propanamide;hydrochloride (PubChem CID 120601915) has the molecular formula C16H24BrClN2OS and a molecular weight of 407.81 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-2-methyl-N-(2-methylpiperidin-4-yl)propanamide;hydrochloride.
| Compound Name | 2-(4-bromophenyl)sulfanyl-2-methyl-N-(2-methylpiperidin-4-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120601915 |
| Molecular Formula | C16H24BrClN2OS |
| Molecular Weight | 407.81 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-2-methyl-N-(2-methylpiperidin-4-yl)propanamide;hydrochloride |
| SMILES | CC1CC(NC(=O)C(C)(C)Sc2ccc(Br)cc2)CCN1.Cl |
| InChI | InChI=1S/C16H23BrN2OS.ClH/c1-11-10-13(8-9-18-11)19-15(20)16(2,3)21-14-6-4-12(17)5-7-14;/h4-7,11,13,18H,8-10H2,1-3H3,(H,19,20);1H |
| InChIKey | NGOSCNQFZPLVPX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |