C19H26ClN3O3S — CID 120602534
N-(2-methylpiperidin-4-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride (PubChem CID 120602534) has the molecular formula C19H26ClN3O3S and a molecular weight of 411.96 g/mol. Its IUPAC name is N-(2-methylpiperidin-4-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride.
| Compound Name | N-(2-methylpiperidin-4-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120602534 |
| Molecular Formula | C19H26ClN3O3S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-(2-methylpiperidin-4-yl)-3-(naphthalen-2-ylsulfonylamino)propanamide;hydrochloride |
| SMILES | CC1CC(NC(=O)CCNS(=O)(=O)c2ccc3ccccc3c2)CCN1.Cl |
| InChI | InChI=1S/C19H25N3O3S.ClH/c1-14-12-17(8-10-20-14)22-19(23)9-11-21-26(24,25)18-7-6-15-4-2-3-5-16(15)13-18;/h2-7,13-14,17,20-21H,8-12H2,1H3,(H,22,23);1H |
| InChIKey | WPYOOUIBPSUAHQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |