C18H24N6O — CID 120603034
2-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-1-phenylguanidine (PubChem CID 120603034) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-1-phenylguanidine.
| Compound Name | 2-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 120603034 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-1-phenylguanidine |
| SMILES | Cc1c([C@H]2[C@H](C/N=C(\N)Nc3ccccc3)CC(=O)N2C)cnn1C |
| InChI | InChI=1S/C18H24N6O/c1-12-15(11-21-24(12)3)17-13(9-16(25)23(17)2)10-20-18(19)22-14-7-5-4-6-8-14/h4-8,11,13,17H,9-10H2,1-3H3,(H3,19,20,22)/t13-,17+/m0/s1 |
| InChIKey | SZWRQZBWRHNGCW-SUMWQHHRSA-N |
| XLogP | 1.67 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|