C16H27IN6O — CID 120603067
1-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 120603067) has the molecular formula C16H27IN6O and a molecular weight of 446.34 g/mol. Its IUPAC name is 1-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 1-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120603067 |
| Molecular Formula | C16H27IN6O |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-[[(2R,3S)-2-(1,5-dimethylpyrazol-4-yl)-1-methyl-5-oxopyrrolidin-3-yl]methyl]-2-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)C/N=C(\N)NC[C@@H]1CC(=O)N(C)[C@H]1c1cnn(C)c1C.I |
| InChI | InChI=1S/C16H26N6O.HI/c1-10(2)7-18-16(17)19-8-12-6-14(23)21(4)15(12)13-9-20-22(5)11(13)3;/h9,12,15H,1,6-8H2,2-5H3,(H3,17,18,19);1H/t12-,15+;/m0./s1 |
| InChIKey | JEAZBKASJXHHNK-SBKWZQTDSA-N |
| XLogP | 1.35 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|