C17H26ClN3O4 — CID 120603852
N-(2-aminoethyl)-2-[3-(oxolan-2-ylmethoxy)propanoylamino]benzamide;hydrochloride (PubChem CID 120603852) has the molecular formula C17H26ClN3O4 and a molecular weight of 371.87 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[3-(oxolan-2-ylmethoxy)propanoylamino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[3-(oxolan-2-ylmethoxy)propanoylamino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120603852 |
| Molecular Formula | C17H26ClN3O4 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-(2-aminoethyl)-2-[3-(oxolan-2-ylmethoxy)propanoylamino]benzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1ccccc1NC(=O)CCOCC1CCCO1 |
| InChI | InChI=1S/C17H25N3O4.ClH/c18-8-9-19-17(22)14-5-1-2-6-15(14)20-16(21)7-11-23-12-13-4-3-10-24-13;/h1-2,5-6,13H,3-4,7-12,18H2,(H,19,22)(H,20,21);1H |
| InChIKey | REHQIYIEXPSYLX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|