C21H28ClN3O2S — CID 120603877
N-(2-aminoethyl)-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]benzamide;hydrochloride (PubChem CID 120603877) has the molecular formula C21H28ClN3O2S and a molecular weight of 421.99 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120603877 |
| Molecular Formula | C21H28ClN3O2S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-(2-aminoethyl)-2-[[2-(4-tert-butylphenyl)sulfanylacetyl]amino]benzamide;hydrochloride |
| SMILES | CC(C)(C)c1ccc(SCC(=O)Nc2ccccc2C(=O)NCCN)cc1.Cl |
| InChI | InChI=1S/C21H27N3O2S.ClH/c1-21(2,3)15-8-10-16(11-9-15)27-14-19(25)24-18-7-5-4-6-17(18)20(26)23-13-12-22;/h4-11H,12-14,22H2,1-3H3,(H,23,26)(H,24,25);1H |
| InChIKey | IQGFPVFILPKBMX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |