C23H29ClFN3O2 — CID 120608968
1-[3-(2-aminophenyl)propanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 120608968) has the molecular formula C23H29ClFN3O2 and a molecular weight of 433.96 g/mol. Its IUPAC name is 1-[3-(2-aminophenyl)propanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 1-[3-(2-aminophenyl)propanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120608968 |
| Molecular Formula | C23H29ClFN3O2 |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 1-[3-(2-aminophenyl)propanoyl]-N-[(3-fluoro-4-methylphenyl)methyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | Cc1ccc(CNC(=O)C2CCN(C(=O)CCc3ccccc3N)CC2)cc1F.Cl |
| InChI | InChI=1S/C23H28FN3O2.ClH/c1-16-6-7-17(14-20(16)24)15-26-23(29)19-10-12-27(13-11-19)22(28)9-8-18-4-2-3-5-21(18)25;/h2-7,14,19H,8-13,15,25H2,1H3,(H,26,29);1H |
| InChIKey | PYVONZZDEDRTRN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|