C19H21N3OS — CID 120613503
3-(2-aminophenyl)-N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]propanamide (PubChem CID 120613503) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]propanamide |
|---|---|
| PubChem CID | 120613503 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 3-(2-aminophenyl)-N-[1-(1,3-benzothiazol-2-yl)propan-2-yl]propanamide |
| SMILES | CC(Cc1nc2ccccc2s1)NC(=O)CCc1ccccc1N |
| InChI | InChI=1S/C19H21N3OS/c1-13(12-19-22-16-8-4-5-9-17(16)24-19)21-18(23)11-10-14-6-2-3-7-15(14)20/h2-9,13H,10-12,20H2,1H3,(H,21,23) |
| InChIKey | JLGWDPGITIYQRB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|