C16H20N2O4 — CID 120614345
(2S)-2-[3-(1,3-benzoxazol-2-yl)propanoylamino]hexanoic acid (PubChem CID 120614345) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (2S)-2-[3-(1,3-benzoxazol-2-yl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[3-(1,3-benzoxazol-2-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 120614345 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2S)-2-[3-(1,3-benzoxazol-2-yl)propanoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CCc1nc2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C16H20N2O4/c1-2-3-6-12(16(20)21)17-14(19)9-10-15-18-11-7-4-5-8-13(11)22-15/h4-5,7-8,12H,2-3,6,9-10H2,1H3,(H,17,19)(H,20,21)/t12-/m0/s1 |
| InChIKey | KWFJGUPJHPXSRN-LBPRGKRZSA-N |
| XLogP | 2.52 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |