C53H43N3P4S4 — CID 12061654
2-N,2-N,6-N,6-N-tetrakis(diphenylphosphinothioyl)pyridine-2,6-diamine (PubChem CID 12061654) has the molecular formula C53H43N3P4S4 and a molecular weight of 974.11 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N-tetrakis(diphenylphosphinothioyl)pyridine-2,6-diamine.
| Compound Name | 2-N,2-N,6-N,6-N-tetrakis(diphenylphosphinothioyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 12061654 |
| Molecular Formula | C53H43N3P4S4 |
| Molecular Weight | 974.11 g/mol |
| Exact Mass | 973.13 |
| IUPAC Name | 2-N,2-N,6-N,6-N-tetrakis(diphenylphosphinothioyl)pyridine-2,6-diamine |
| SMILES | S=P(c1ccccc1)(c1ccccc1)N(c1cccc(N(P(=S)(c2ccccc2)c2ccccc2)P(=S)(c2ccccc2)c2ccccc2)n1)P(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H43N3P4S4/c61-57(44-26-9-1-10-27-44,45-28-11-2-12-29-45)55(58(62,46-30-13-3-14-31-46)47-32-15-4-16-33-47)52-42-25-43-53(54-52)56(59(63,48-34-17-5-18-35-48)49-36-19-6-20-37-49)60(64,50-38-21-7-22-39-50)51-40-23-8-24-41-51/h1-43H |
| InChIKey | SLDUXKNNTWYZRC-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.11 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|