C16H30ClN3O — CID 120639174
(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[(2S,4S)-2-methylpiperidin-4-yl]methanone;hydrochloride (PubChem CID 120639174) has the molecular formula C16H30ClN3O and a molecular weight of 315.89 g/mol. Its IUPAC name is (1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[(2S,4S)-2-methylpiperidin-4-yl]methanone;hydrochloride.
| Compound Name | (1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[(2S,4S)-2-methylpiperidin-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120639174 |
| Molecular Formula | C16H30ClN3O |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | (1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)-[(2S,4S)-2-methylpiperidin-4-yl]methanone;hydrochloride |
| SMILES | C[C@H]1C[C@@H](C(=O)N2CCC3C(CCCN3C)C2)CCN1.Cl |
| InChI | InChI=1S/C16H29N3O.ClH/c1-12-10-13(5-7-17-12)16(20)19-9-6-15-14(11-19)4-3-8-18(15)2;/h12-15,17H,3-11H2,1-2H3;1H/t12-,13-,14?,15?;/m0./s1 |
| InChIKey | AXOXULHYEKPKPY-DAODMAHZSA-N |
| XLogP | 1.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |