C19H34ClN3O — CID 120992922
(9-amino-3-bicyclo[3.3.1]nonanyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone;hydrochloride (PubChem CID 120992922) has the molecular formula C19H34ClN3O and a molecular weight of 355.95 g/mol. Its IUPAC name is (9-amino-3-bicyclo[3.3.1]nonanyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone;hydrochloride.
| Compound Name | (9-amino-3-bicyclo[3.3.1]nonanyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120992922 |
| Molecular Formula | C19H34ClN3O |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (9-amino-3-bicyclo[3.3.1]nonanyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone;hydrochloride |
| SMILES | CN1CCCC2CN(C(=O)C3CC4CCCC(C3)C4N)CCC21.Cl |
| InChI | InChI=1S/C19H33N3O.ClH/c1-21-8-3-6-15-12-22(9-7-17(15)21)19(23)16-10-13-4-2-5-14(11-16)18(13)20;/h13-18H,2-12,20H2,1H3;1H |
| InChIKey | NNNKJHMBILJGPN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |