C19H22BrN3O — CID 120645355
5-amino-N-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methylbenzamide (PubChem CID 120645355) has the molecular formula C19H22BrN3O and a molecular weight of 388.31 g/mol. Its IUPAC name is 5-amino-N-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 120645355 |
| Molecular Formula | C19H22BrN3O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 5-amino-N-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NCC1CCN(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C19H22BrN3O/c1-13-5-6-16(21)10-18(13)19(24)22-11-14-7-8-23(12-14)17-4-2-3-15(20)9-17/h2-6,9-10,14H,7-8,11-12,21H2,1H3,(H,22,24) |
| InChIKey | DCJVONWTZYMWDI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|