C21H29Cl2N3O — CID 120645543
5-amino-2-methyl-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]benzamide;dihydrochloride (PubChem CID 120645543) has the molecular formula C21H29Cl2N3O and a molecular weight of 410.39 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]benzamide;dihydrochloride.
| Compound Name | 5-amino-2-methyl-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120645543 |
| Molecular Formula | C21H29Cl2N3O |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 5-amino-2-methyl-N-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]benzamide;dihydrochloride |
| SMILES | Cc1ccc(N)cc1C(=O)NCC1CCN(CCc2ccccc2)C1.Cl.Cl |
| InChI | InChI=1S/C21H27N3O.2ClH/c1-16-7-8-19(22)13-20(16)21(25)23-14-18-10-12-24(15-18)11-9-17-5-3-2-4-6-17;;/h2-8,13,18H,9-12,14-15,22H2,1H3,(H,23,25);2*1H |
| InChIKey | NRKAAUDRSAUALW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|