C19H29BrN4O — CID 52535572
1-[[(3R)-1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-(2-piperidin-1-ylethyl)urea (PubChem CID 52535572) has the molecular formula C19H29BrN4O and a molecular weight of 409.37 g/mol. Its IUPAC name is 1-[[(3R)-1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-(2-piperidin-1-ylethyl)urea.
| Compound Name | 1-[[(3R)-1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-(2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 52535572 |
| Molecular Formula | C19H29BrN4O |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[[(3R)-1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-(2-piperidin-1-ylethyl)urea |
| SMILES | O=C(NCCN1CCCCC1)NC[C@H]1CCN(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C19H29BrN4O/c20-17-5-4-6-18(13-17)24-11-7-16(15-24)14-22-19(25)21-8-12-23-9-2-1-3-10-23/h4-6,13,16H,1-3,7-12,14-15H2,(H2,21,22,25)/t16-/m1/s1 |
| InChIKey | QWPSUPOANKZLBC-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |