C20H28BrN3O — CID 60583866
1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-[2-(cyclohexen-1-yl)ethyl]urea (PubChem CID 60583866) has the molecular formula C20H28BrN3O and a molecular weight of 406.37 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-[2-(cyclohexen-1-yl)ethyl]urea.
| Compound Name | 1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-[2-(cyclohexen-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 60583866 |
| Molecular Formula | C20H28BrN3O |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-3-[2-(cyclohexen-1-yl)ethyl]urea |
| SMILES | O=C(NCCC1=CCCCC1)NCC1CCN(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C20H28BrN3O/c21-18-7-4-8-19(13-18)24-12-10-17(15-24)14-23-20(25)22-11-9-16-5-2-1-3-6-16/h4-5,7-8,13,17H,1-3,6,9-12,14-15H2,(H2,22,23,25) |
| InChIKey | KFYPEVAEDMBHSF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|