C12H17ClFIN2O — CID 120650172
N-[(2R)-2-(ethylamino)propyl]-2-fluoro-6-iodobenzamide;hydrochloride (PubChem CID 120650172) has the molecular formula C12H17ClFIN2O and a molecular weight of 386.64 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-fluoro-6-iodobenzamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-fluoro-6-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120650172 |
| Molecular Formula | C12H17ClFIN2O |
| Molecular Weight | 386.64 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-fluoro-6-iodobenzamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)c1c(F)cccc1I.Cl |
| InChI | InChI=1S/C12H16FIN2O.ClH/c1-3-15-8(2)7-16-12(17)11-9(13)5-4-6-10(11)14;/h4-6,8,15H,3,7H2,1-2H3,(H,16,17);1H/t8-;/m1./s1 |
| InChIKey | YSVYIHBJYJGJBK-DDWIOCJRSA-N |
| XLogP | 2.58 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.64 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|