C16H22BrCl2N3O — CID 120651332
7-bromo-N-[(2R)-2-(ethylamino)propyl]-2-methylquinoline-4-carboxamide;dihydrochloride (PubChem CID 120651332) has the molecular formula C16H22BrCl2N3O and a molecular weight of 423.18 g/mol. Its IUPAC name is 7-bromo-N-[(2R)-2-(ethylamino)propyl]-2-methylquinoline-4-carboxamide;dihydrochloride.
| Compound Name | 7-bromo-N-[(2R)-2-(ethylamino)propyl]-2-methylquinoline-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120651332 |
| Molecular Formula | C16H22BrCl2N3O |
| Molecular Weight | 423.18 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 7-bromo-N-[(2R)-2-(ethylamino)propyl]-2-methylquinoline-4-carboxamide;dihydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)c1cc(C)nc2cc(Br)ccc12.Cl.Cl |
| InChI | InChI=1S/C16H20BrN3O.2ClH/c1-4-18-11(3)9-19-16(21)14-7-10(2)20-15-8-12(17)5-6-13(14)15;;/h5-8,11,18H,4,9H2,1-3H3,(H,19,21);2*1H/t11-;;/m1../s1 |
| InChIKey | VGRXNSBSOQYUCR-NVJADKKVSA-N |
| XLogP | 3.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |