C11H25N3O4S — CID 120651471
2-(2-ethoxyethylsulfonylamino)-N-[(2R)-2-(ethylamino)propyl]acetamide (PubChem CID 120651471) has the molecular formula C11H25N3O4S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfonylamino)-N-[(2R)-2-(ethylamino)propyl]acetamide.
| Compound Name | 2-(2-ethoxyethylsulfonylamino)-N-[(2R)-2-(ethylamino)propyl]acetamide |
|---|---|
| PubChem CID | 120651471 |
| Molecular Formula | C11H25N3O4S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(2-ethoxyethylsulfonylamino)-N-[(2R)-2-(ethylamino)propyl]acetamide |
| SMILES | CCN[C@H](C)CNC(=O)CNS(=O)(=O)CCOCC |
| InChI | InChI=1S/C11H25N3O4S/c1-4-12-10(3)8-13-11(15)9-14-19(16,17)7-6-18-5-2/h10,12,14H,4-9H2,1-3H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | JNPAZUWSRFYOJW-SNVBAGLBSA-N |
| XLogP | -0.94 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|