C19H26ClN5O4 — CID 120655860
1-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone;hydrochloride (PubChem CID 120655860) has the molecular formula C19H26ClN5O4 and a molecular weight of 423.90 g/mol. Its IUPAC name is 1-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 1-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120655860 |
| Molecular Formula | C19H26ClN5O4 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-[4-[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone;hydrochloride |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)N3C[C@H]4CNC[C@H]4C3)cc2[N+](=O)[O-])CC1.Cl |
| InChI | InChI=1S/C19H25N5O4.ClH/c1-13(25)21-4-6-22(7-5-21)17-3-2-14(8-18(17)24(27)28)19(26)23-11-15-9-20-10-16(15)12-23;/h2-3,8,15-16,20H,4-7,9-12H2,1H3;1H/t15-,16+; |
| InChIKey | FRSZTQOUKGAENW-FAESNJTISA-N |
| XLogP | 0.98 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|