C16H21BrN2OS — CID 120658206
1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromophenyl)sulfanyl-2-methylpropan-1-one (PubChem CID 120658206) has the molecular formula C16H21BrN2OS and a molecular weight of 369.33 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromophenyl)sulfanyl-2-methylpropan-1-one.
| Compound Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromophenyl)sulfanyl-2-methylpropan-1-one |
|---|---|
| PubChem CID | 120658206 |
| Molecular Formula | C16H21BrN2OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 1-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-(4-bromophenyl)sulfanyl-2-methylpropan-1-one |
| SMILES | CC(C)(Sc1ccc(Br)cc1)C(=O)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H21BrN2OS/c1-16(2,21-14-5-3-13(17)4-6-14)15(20)19-9-11-7-18-8-12(11)10-19/h3-6,11-12,18H,7-10H2,1-2H3/t11-,12+ |
| InChIKey | CYDPZHUBAOVGNR-TXEJJXNPSA-N |
| XLogP | 3.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |