C16H19ClF2N2O — CID 120659754
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-difluorophenyl)cyclopropyl]methanone;hydrochloride (PubChem CID 120659754) has the molecular formula C16H19ClF2N2O and a molecular weight of 328.79 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-difluorophenyl)cyclopropyl]methanone;hydrochloride.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-difluorophenyl)cyclopropyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120659754 |
| Molecular Formula | C16H19ClF2N2O |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-difluorophenyl)cyclopropyl]methanone;hydrochloride |
| SMILES | Cl.O=C(C1CC1c1ccc(F)cc1F)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H18F2N2O.ClH/c17-11-1-2-12(15(18)3-11)13-4-14(13)16(21)20-7-9-5-19-6-10(9)8-20;/h1-3,9-10,13-14,19H,4-8H2;1H/t9-,10+,13?,14?; |
| InChIKey | AZQJYKZBGMYOMV-SNQZSCJFSA-N |
| XLogP | 2.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |