C16H25ClN2 — CID 120660971
(3aR,6aS)-5-[(2,4,5-trimethylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660971) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is (3aR,6aS)-5-[(2,4,5-trimethylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(2,4,5-trimethylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660971 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (3aR,6aS)-5-[(2,4,5-trimethylphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | Cc1cc(C)c(CN2C[C@H]3CNC[C@H]3C2)cc1C.Cl |
| InChI | InChI=1S/C16H24N2.ClH/c1-11-4-13(3)14(5-12(11)2)8-18-9-15-6-17-7-16(15)10-18;/h4-5,15-17H,6-10H2,1-3H3;1H/t15-,16+; |
| InChIKey | YPOSITNQFMFUOU-FAESNJTISA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |