C18H23IN4O — CID 120662345
1-[(1,3-dimethylindol-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine;hydroiodide (PubChem CID 120662345) has the molecular formula C18H23IN4O and a molecular weight of 438.31 g/mol. Its IUPAC name is 1-[(1,3-dimethylindol-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(1,3-dimethylindol-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120662345 |
| Molecular Formula | C18H23IN4O |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-[(1,3-dimethylindol-2-yl)methyl]-3-(furan-2-ylmethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccco1)NCc1c(C)c2ccccc2n1C.I |
| InChI | InChI=1S/C18H22N4O.HI/c1-13-15-8-4-5-9-16(15)22(3)17(13)12-21-18(19-2)20-11-14-7-6-10-23-14;/h4-10H,11-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | LBNIEYIXKJDWMY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|