C11H17IN6O — CID 119114637
1-(furan-2-ylmethyl)-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 119114637) has the molecular formula C11H17IN6O and a molecular weight of 376.20 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119114637 |
| Molecular Formula | C11H17IN6O |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCn1cncn1)NCc1ccco1.I |
| InChI | InChI=1S/C11H16N6O.HI/c1-12-11(15-7-10-3-2-6-18-10)14-4-5-17-9-13-8-16-17;/h2-3,6,8-9H,4-5,7H2,1H3,(H2,12,14,15);1H |
| InChIKey | QLBNEYVWLAJRPQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|