C12H19N7S — CID 119163257
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine (PubChem CID 119163257) has the molecular formula C12H19N7S and a molecular weight of 293.40 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine.
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119163257 |
| Molecular Formula | C12H19N7S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-2-methyl-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cncn1)NCc1sc(C)nc1C |
| InChI | InChI=1S/C12H19N7S/c1-9-11(20-10(2)18-9)6-16-12(13-3)15-4-5-19-8-14-7-17-19/h7-8H,4-6H2,1-3H3,(H2,13,15,16) |
| InChIKey | ZMISBVDLMNVZBT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|