C11H17N7S — CID 119117020
2-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine (PubChem CID 119117020) has the molecular formula C11H17N7S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119117020 |
| Molecular Formula | C11H17N7S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-methyl-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
| SMILES | C/N=C(\NCCn1cncn1)NCc1nc(C)cs1 |
| InChI | InChI=1S/C11H17N7S/c1-9-6-19-10(17-9)5-15-11(12-2)14-3-4-18-8-13-7-16-18/h6-8H,3-5H2,1-2H3,(H2,12,14,15) |
| InChIKey | VQVDCCFRWOBNJL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|