C12H22IN3 — CID 120666045
2-(cyclobutylmethyl)-1-[(1R,2S)-2-cyclopropylcyclopropyl]guanidine;hydroiodide (PubChem CID 120666045) has the molecular formula C12H22IN3 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[(1R,2S)-2-cyclopropylcyclopropyl]guanidine;hydroiodide.
| Compound Name | 2-(cyclobutylmethyl)-1-[(1R,2S)-2-cyclopropylcyclopropyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120666045 |
| Molecular Formula | C12H22IN3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[(1R,2S)-2-cyclopropylcyclopropyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCC1)N[C@@H]1C[C@H]1C1CC1 |
| InChI | InChI=1S/C12H21N3.HI/c13-12(14-7-8-2-1-3-8)15-11-6-10(11)9-4-5-9;/h8-11H,1-7H2,(H3,13,14,15);1H/t10-,11+;/m0./s1 |
| InChIKey | PVTUTDYLIMFQIE-VZXYPILPSA-N |
| XLogP | 2.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|