C8H16IN3 — CID 130614190
1-(2-cyclopropylcyclopropyl)-2-methylguanidine;hydroiodide (PubChem CID 130614190) has the molecular formula C8H16IN3 and a molecular weight of 281.14 g/mol. Its IUPAC name is 1-(2-cyclopropylcyclopropyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-cyclopropylcyclopropyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 130614190 |
| Molecular Formula | C8H16IN3 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 1-(2-cyclopropylcyclopropyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\N)NC1CC1C1CC1.I |
| InChI | InChI=1S/C8H15N3.HI/c1-10-8(9)11-7-4-6(7)5-2-3-5;/h5-7H,2-4H2,1H3,(H3,9,10,11);1H |
| InChIKey | IMFSNBTWZXYEHG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|