C13H20IN3S — CID 120666065
1-[(1R,2S)-2-cyclopropylcyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 120666065) has the molecular formula C13H20IN3S and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-[(1R,2S)-2-cyclopropylcyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(1R,2S)-2-cyclopropylcyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120666065 |
| Molecular Formula | C13H20IN3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 1-[(1R,2S)-2-cyclopropylcyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1cccs1)N[C@@H]1C[C@H]1C1CC1 |
| InChI | InChI=1S/C13H19N3S.HI/c14-13(15-6-5-10-2-1-7-17-10)16-12-8-11(12)9-3-4-9;/h1-2,7,9,11-12H,3-6,8H2,(H3,14,15,16);1H/t11-,12+;/m0./s1 |
| InChIKey | QOFHTGJWNVHWLA-ZVWHLABXSA-N |
| XLogP | 2.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|