C17H19N3S — CID 119164356
1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-2-(2-thiophen-2-ylethyl)guanidine (PubChem CID 119164356) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-2-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-2-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 119164356 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-2-(2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\CCc1cccs1)NC1C2Cc3ccccc3C21 |
| InChI | InChI=1S/C17H19N3S/c18-17(19-8-7-12-5-3-9-21-12)20-16-14-10-11-4-1-2-6-13(11)15(14)16/h1-6,9,14-16H,7-8,10H2,(H3,18,19,20) |
| InChIKey | CKUDWSLSSZBICM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|