C15H21N3 — CID 99849049
1-[(1R,1aR,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-diethylguanidine (PubChem CID 99849049) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-[(1R,1aR,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-diethylguanidine.
| Compound Name | 1-[(1R,1aR,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-diethylguanidine |
|---|---|
| PubChem CID | 99849049 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 1-[(1R,1aR,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-diethylguanidine |
| SMILES | CC/N=C(\NCC)N[C@@H]1[C@H]2Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C15H21N3/c1-3-16-15(17-4-2)18-14-12-9-10-7-5-6-8-11(10)13(12)14/h5-8,12-14H,3-4,9H2,1-2H3,(H2,16,17,18)/t12-,13-,14+/m0/s1 |
| InChIKey | FKKAHUXGKZGAKX-MELADBBJSA-N |
| XLogP | 1.90 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|