C15H21ClN2O — CID 119822539
N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-4-(methylamino)butanamide;hydrochloride (PubChem CID 119822539) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119822539 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl)-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC1C2Cc3ccccc3C21.Cl |
| InChI | InChI=1S/C15H20N2O.ClH/c1-16-8-4-7-13(18)17-15-12-9-10-5-2-3-6-11(10)14(12)15;/h2-3,5-6,12,14-16H,4,7-9H2,1H3,(H,17,18);1H |
| InChIKey | ARVWYPODULCJAC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|