C17H15NO3 — CID 124625638
N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-dihydroxybenzamide (PubChem CID 124625638) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-dihydroxybenzamide.
| Compound Name | N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 124625638 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3-dihydroxybenzamide |
| SMILES | O=C(N[C@@H]1[C@@H]2Cc3ccccc3[C@H]21)c1cccc(O)c1O |
| InChI | InChI=1S/C17H15NO3/c19-13-7-3-6-11(16(13)20)17(21)18-15-12-8-9-4-1-2-5-10(9)14(12)15/h1-7,12,14-15,19-20H,8H2,(H,18,21)/t12-,14-,15-/m1/s1 |
| InChIKey | WHNNJRLGYFVROA-BPLDGKMQSA-N |
| XLogP | 2.17 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|