C17H13F2NO2 — CID 124846643
N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,6-difluoro-3-hydroxybenzamide (PubChem CID 124846643) has the molecular formula C17H13F2NO2 and a molecular weight of 301.29 g/mol. Its IUPAC name is N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,6-difluoro-3-hydroxybenzamide.
| Compound Name | N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,6-difluoro-3-hydroxybenzamide |
|---|---|
| PubChem CID | 124846643 |
| Molecular Formula | C17H13F2NO2 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,6-difluoro-3-hydroxybenzamide |
| SMILES | O=C(N[C@@H]1[C@@H]2Cc3ccccc3[C@H]21)c1c(F)ccc(O)c1F |
| InChI | InChI=1S/C17H13F2NO2/c18-11-5-6-12(21)15(19)14(11)17(22)20-16-10-7-8-3-1-2-4-9(8)13(10)16/h1-6,10,13,16,21H,7H2,(H,20,22)/t10-,13-,16-/m1/s1 |
| InChIKey | JCGZFNAWTXDUCS-CKUKBARFSA-N |
| XLogP | 2.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |